CAS 2026790-34-9 is the registry number for 3-{((2R,6S)-2,6-Dimethylmorpholin-4-yl)methyl}aniline. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
3-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]aniline (CAS 2026790-34-9) is a chemical compound with the molecular formula C13H20N2O and a molecular weight of 220.31 g/mol. IUPAC name: 3-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]aniline. InChIKey: SAPOZTKSZOJTJM-PHIMTYICSA-N.
| Molecular formula | C13H20N2O |
|---|---|
| Molecular weight | 220.31 g/mol |
| IUPAC name | 3-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]aniline |
| InChIKey | SAPOZTKSZOJTJM-PHIMTYICSA-N |
| SMILES | C[C@@H]1CN(C[C@@H](O1)C)CC2=CC(=CC=C2)N |
Computed by PubChem (NCBI)