CAS 20271-34-5 is the registry number for 5-Amino-1-benzyl-1H-1,2,3-triazole-4-carbothioamide. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
5-amino-1-benzyltriazole-4-carbothioamide (CAS 20271-34-5) is a chemical compound with the molecular formula C10H11N5S and a molecular weight of 233.30 g/mol. IUPAC name: 5-amino-1-benzyltriazole-4-carbothioamide. InChIKey: XQTIYEPLNKHOQF-UHFFFAOYSA-N.
| Molecular formula | C10H11N5S |
|---|---|
| Molecular weight | 233.30 g/mol |
| IUPAC name | 5-amino-1-benzyltriazole-4-carbothioamide |
| InChIKey | XQTIYEPLNKHOQF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C(=C(N=N2)C(=S)N)N |
Computed by PubChem (NCBI)