CAS 353461-41-3 is the registry number for 2-((Pyridin-2-ylmethyl)thio)pyrimidine-4,6-diamine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(pyridin-2-ylmethylsulfanyl)pyrimidine-4,6-diamine (CAS 353461-41-3) is a chemical compound with the molecular formula C10H11N5S and a molecular weight of 233.30 g/mol. IUPAC name: 2-(pyridin-2-ylmethylsulfanyl)pyrimidine-4,6-diamine. InChIKey: RKSKZICWYUPSIX-UHFFFAOYSA-N.
| Molecular formula | C10H11N5S |
|---|---|
| Molecular weight | 233.30 g/mol |
| IUPAC name | 2-(pyridin-2-ylmethylsulfanyl)pyrimidine-4,6-diamine |
| InChIKey | RKSKZICWYUPSIX-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)CSC2=NC(=CC(=N2)N)N |
Computed by PubChem (NCBI)