Products 202737-32-4
CAS 202737-32-4 appears in our catalog under these names: 1–(m–tolyl)cyclobutane–1–carboxylic acid, 1-(3-Methylphenyl)cyclobutane-1-carboxylic acid, 1-(M-Tolyl)Cyclobutanecarboxylic acid, 1-(3-METHYLPHENYL)CYCLOBUTANECARBOXYLIC ACID, 90%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 50mg, 0,5g.
1-(3-methylphenyl)cyclobutane-1-carboxylic acid (CAS 202737-32-4) is a chemical compound with the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. IUPAC name: 1-(3-methylphenyl)cyclobutane-1-carboxylic acid. InChIKey: SSPYKVRECSNVLY-UHFFFAOYSA-N.
| Molecular formula | C12H14O2 |
|---|---|
| Molecular weight | 190.24 g/mol |
| IUPAC name | 1-(3-methylphenyl)cyclobutane-1-carboxylic acid |
| InChIKey | SSPYKVRECSNVLY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2(CCC2)C(=O)O |
Computed by PubChem (NCBI)