Products 202925-02-8
CAS 202925-02-8 is the registry number for 2-Iodo-3,4,5-trifluorobromobenzene, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
1-bromo-3,4,5-trifluoro-2-iodobenzene (CAS 202925-02-8) is a chemical compound with the molecular formula C6HBrF3I and a molecular weight of 336.88 g/mol. IUPAC name: 1-bromo-3,4,5-trifluoro-2-iodobenzene. InChIKey: IJOUXZJVNMNVFB-UHFFFAOYSA-N.
| Molecular formula | C6HBrF3I |
|---|---|
| Molecular weight | 336.88 g/mol |
| IUPAC name | 1-bromo-3,4,5-trifluoro-2-iodobenzene |
| InChIKey | IJOUXZJVNMNVFB-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)I)F)F)F |
Computed by PubChem (NCBI)