Products 530145-58-5
CAS 530145-58-5 appears in our catalog under these names: 2-Bromo-3,4,5-trifluoroiodobenzene, 98%, 98%, 2-Bromo-3,4,5-trifluoroiodobenzene, 96%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 5g.
4-bromo-1,2,3-trifluoro-5-iodobenzene (CAS 530145-58-5) is a chemical compound with the molecular formula C6HBrF3I and a molecular weight of 336.88 g/mol. IUPAC name: 4-bromo-1,2,3-trifluoro-5-iodobenzene. InChIKey: ZLOJTBMNSZMLBI-UHFFFAOYSA-N.
| Molecular formula | C6HBrF3I |
|---|---|
| Molecular weight | 336.88 g/mol |
| IUPAC name | 4-bromo-1,2,3-trifluoro-5-iodobenzene |
| InChIKey | ZLOJTBMNSZMLBI-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1I)Br)F)F)F |
Computed by PubChem (NCBI)