Products 2029729-60-8
CAS 2029729-60-8 is the registry number for tert-Butyl 3-(5-bromofuran-2-yl)propanoate 98%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g, 10g.
Tert-butyl 3-(5-bromofuran-2-yl)propanoate (CAS 2029729-60-8) is a chemical compound with the molecular formula C11H15BrO3 and a molecular weight of 275.14 g/mol. IUPAC name: tert-butyl 3-(5-bromofuran-2-yl)propanoate. InChIKey: PRSAKDCBJROLEE-UHFFFAOYSA-N.
| Molecular formula | C11H15BrO3 |
|---|---|
| Molecular weight | 275.14 g/mol |
| IUPAC name | tert-butyl 3-(5-bromofuran-2-yl)propanoate |
| InChIKey | PRSAKDCBJROLEE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCC1=CC=C(O1)Br |
Computed by PubChem (NCBI)