Products 2228296-99-7
CAS 2228296-99-7 is the registry number for 2-(4-Bromo-2,6-dimethoxyphenyl)propan-2-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-bromo-2,6-dimethoxyphenyl)propan-2-ol (CAS 2228296-99-7) is a chemical compound with the molecular formula C11H15BrO3 and a molecular weight of 275.14 g/mol. IUPAC name: 2-(4-bromo-2,6-dimethoxyphenyl)propan-2-ol. InChIKey: GIUZBYLLZSBGDD-UHFFFAOYSA-N.
| Molecular formula | C11H15BrO3 |
|---|---|
| Molecular weight | 275.14 g/mol |
| IUPAC name | 2-(4-bromo-2,6-dimethoxyphenyl)propan-2-ol |
| InChIKey | GIUZBYLLZSBGDD-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=C(C=C(C=C1OC)Br)OC)O |
Computed by PubChem (NCBI)