CAS 203007-70-9 appears in our catalog under these names: 3,3'-Bis(trifluoromethyl)-[1,1'-biphenyl]-4,4'-dicarboxylic acid, 97%, 97%, 3,3'-Bis(trifluoromethyl)-[1,1'-biphenyl]-4,4'-dicarboxylic acid, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
4-[4-carboxy-3-(trifluoromethyl)phenyl]-2-(trifluoromethyl)benzoic acid (CAS 203007-70-9) is a chemical compound with the molecular formula C16H8F6O4 and a molecular weight of 378.22 g/mol. IUPAC name: 4-[4-carboxy-3-(trifluoromethyl)phenyl]-2-(trifluoromethyl)benzoic acid. InChIKey: SLGHUURPYNJHJN-UHFFFAOYSA-N.
| Molecular formula | C16H8F6O4 |
|---|---|
| Molecular weight | 378.22 g/mol |
| IUPAC name | 4-[4-carboxy-3-(trifluoromethyl)phenyl]-2-(trifluoromethyl)benzoic acid |
| InChIKey | SLGHUURPYNJHJN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CC(=C(C=C2)C(=O)O)C(F)(F)F)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)