CAS 89803-71-4 appears in our catalog under these names: 2,2'-Bis(trifluoromethyl)-[1,1'-biphenyl]-4,4'-dicarboxylic acid, 95%, 2,2'-Bis(trifluoromethyl)-[1,1'-biphenyl]-4,4'-dicarboxylic acid, 98%, 98%, 2,2'-Bis(trifluoromethyl)-[1,1'-biphenyl]-4,4'-dicarboxylic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 100mg, 200mg.
4-[4-carboxy-2-(trifluoromethyl)phenyl]-3-(trifluoromethyl)benzoic acid (CAS 89803-71-4) is a chemical compound with the molecular formula C16H8F6O4 and a molecular weight of 378.22 g/mol. IUPAC name: 4-[4-carboxy-2-(trifluoromethyl)phenyl]-3-(trifluoromethyl)benzoic acid. InChIKey: VOSZLKUKKWRKQZ-UHFFFAOYSA-N.
| Molecular formula | C16H8F6O4 |
|---|---|
| Molecular weight | 378.22 g/mol |
| IUPAC name | 4-[4-carboxy-2-(trifluoromethyl)phenyl]-3-(trifluoromethyl)benzoic acid |
| InChIKey | VOSZLKUKKWRKQZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)C(F)(F)F)C2=C(C=C(C=C2)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)