CAS 20304-71-6 is the registry number for Ethacridine Impurity 10. Offered by: Chemat Brand. Available pack sizes: on request.
2-ethoxy-6-nitro-9-phenoxyacridine (CAS 20304-71-6) is a chemical compound with the molecular formula C21H16N2O4 and a molecular weight of 360.4 g/mol. IUPAC name: 2-ethoxy-6-nitro-9-phenoxyacridine. InChIKey: RIJTYXVERSCHCU-UHFFFAOYSA-N.
| Molecular formula | C21H16N2O4 |
|---|---|
| Molecular weight | 360.4 g/mol |
| IUPAC name | 2-ethoxy-6-nitro-9-phenoxyacridine |
| InChIKey | RIJTYXVERSCHCU-UHFFFAOYSA-N |
| SMILES | CCOC1=CC2=C(C3=C(C=C(C=C3)[N+](=O)[O-])N=C2C=C1)OC4=CC=CC=C4 |
Computed by PubChem (NCBI)