Products 306324-94-7

CAS 306324-94-7 is the registry number for 2-((2-(Phenylcarbamoyl)phenyl)carbamoyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[[2-(phenylcarbamoyl)phenyl]carbamoyl]benzoic acid (CAS 306324-94-7) is a chemical compound with the molecular formula C21H16N2O4 and a molecular weight of 360.4 g/mol. IUPAC name: 2-[[2-(phenylcarbamoyl)phenyl]carbamoyl]benzoic acid. InChIKey: MVNHOZLXKLOTDT-UHFFFAOYSA-N.

Identity
Molecular formulaC21H16N2O4
Molecular weight360.4 g/mol
IUPAC name2-[[2-(phenylcarbamoyl)phenyl]carbamoyl]benzoic acid
InChIKeyMVNHOZLXKLOTDT-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)NC(=O)C2=CC=CC=C2NC(=O)C3=CC=CC=C3C(=O)O

Computed by PubChem (NCBI)