CAS 2031242-39-2 is the registry number for (2R,6R)-4,6-Dimethylmorpholine-2-carboxylic acid hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
(2R,6R)-4,6-dimethylmorpholine-2-carboxylic acid;hydrochloride (CAS 2031242-39-2) is a chemical compound with the molecular formula C7H14ClNO3 and a molecular weight of 195.64 g/mol. IUPAC name: (2R,6R)-4,6-dimethylmorpholine-2-carboxylic acid;hydrochloride. InChIKey: MNKXWFXGKGCCDM-KGZKBUQUSA-N.
| Molecular formula | C7H14ClNO3 |
|---|---|
| Molecular weight | 195.64 g/mol |
| IUPAC name | (2R,6R)-4,6-dimethylmorpholine-2-carboxylic acid;hydrochloride |
| InChIKey | MNKXWFXGKGCCDM-KGZKBUQUSA-N |
| SMILES | C[C@@H]1CN(C[C@@H](O1)C(=O)O)C.Cl |
Computed by PubChem (NCBI)