CAS 2031242-45-0 appears in our catalog under these names: ((3S)-3,4-Dihydro-1H-2-benzopyran-3-yl)methanamine, 95%, ((3S)-3,4-Dihydro-1H-2-benzopyran-3-yl)methanamine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
[(3S)-3,4-dihydro-1H-isochromen-3-yl]methanamine (CAS 2031242-45-0) is a chemical compound with the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. IUPAC name: [(3S)-3,4-dihydro-1H-isochromen-3-yl]methanamine. InChIKey: MMZKPTNDPNDNKS-JTQLQIEISA-N.
| Molecular formula | C10H13NO |
|---|---|
| Molecular weight | 163.22 g/mol |
| IUPAC name | [(3S)-3,4-dihydro-1H-isochromen-3-yl]methanamine |
| InChIKey | MMZKPTNDPNDNKS-JTQLQIEISA-N |
| SMILES | C1[C@H](OCC2=CC=CC=C21)CN |
Computed by PubChem (NCBI)