CAS 2031242-74-5 appears in our catalog under these names: (1R,5S)-1,4,4-Trimethyl-3-azabicyclo(3.2.1)octane hydrochloride, 95%, (1R,5S)-1,4,4-Trimethyl-3-azabicyclo(3.2.1)octane hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(1R,5S)-1,4,4-trimethyl-3-azabicyclo[3.2.1]octane;hydrochloride (CAS 2031242-74-5) is a chemical compound with the molecular formula C10H20ClN and a molecular weight of 189.72 g/mol. IUPAC name: (1R,5S)-1,4,4-trimethyl-3-azabicyclo[3.2.1]octane;hydrochloride. InChIKey: WLSBVPNKQWDEGT-KXNXZCPBSA-N.
| Molecular formula | C10H20ClN |
|---|---|
| Molecular weight | 189.72 g/mol |
| IUPAC name | (1R,5S)-1,4,4-trimethyl-3-azabicyclo[3.2.1]octane;hydrochloride |
| InChIKey | WLSBVPNKQWDEGT-KXNXZCPBSA-N |
| SMILES | C[C@@]12CC[C@@H](C1)C(NC2)(C)C.Cl |
Computed by PubChem (NCBI)