Products 2031259-19-3

CAS 2031259-19-3 is the registry number for 4-Methoxy-2-methylpyrrolidine-2-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

4-methoxy-2-methylpyrrolidine-2-carboxylic acid;hydrochloride (CAS 2031259-19-3) is a chemical compound with the molecular formula C7H14ClNO3 and a molecular weight of 195.64 g/mol. IUPAC name: 4-methoxy-2-methylpyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: DHFXCLXYCNQORB-UHFFFAOYSA-N.

Identity
Molecular formulaC7H14ClNO3
Molecular weight195.64 g/mol
IUPAC name4-methoxy-2-methylpyrrolidine-2-carboxylic acid;hydrochloride
InChIKeyDHFXCLXYCNQORB-UHFFFAOYSA-N
SMILESCC1(CC(CN1)OC)C(=O)O.Cl

Computed by PubChem (NCBI)