Products 2031269-43-7
CAS 2031269-43-7 is the registry number for 7-Bromo-N,N-dimethyl-2,3,4,5-tetrahydro-1H-1-benzazepin-3-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
7-bromo-N,N-dimethyl-2,3,4,5-tetrahydro-1H-1-benzazepin-3-amine (CAS 2031269-43-7) is a chemical compound with the molecular formula C12H17BrN2 and a molecular weight of 269.18 g/mol. IUPAC name: 7-bromo-N,N-dimethyl-2,3,4,5-tetrahydro-1H-1-benzazepin-3-amine. InChIKey: VSPBUBMCKSGMHF-UHFFFAOYSA-N.
| Molecular formula | C12H17BrN2 |
|---|---|
| Molecular weight | 269.18 g/mol |
| IUPAC name | 7-bromo-N,N-dimethyl-2,3,4,5-tetrahydro-1H-1-benzazepin-3-amine |
| InChIKey | VSPBUBMCKSGMHF-UHFFFAOYSA-N |
| SMILES | CN(C)C1CCC2=C(C=CC(=C2)Br)NC1 |
Computed by PubChem (NCBI)