CAS 203175-69-3 is the registry number for 4-Bromo-2,6-dimethylphenyl carbonochloridate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4-bromo-2,6-dimethylphenyl) carbonochloridate (CAS 203175-69-3) is a chemical compound with the molecular formula C9H8BrClO2 and a molecular weight of 263.51 g/mol. IUPAC name: (4-bromo-2,6-dimethylphenyl) carbonochloridate. InChIKey: SGLZHKPOXRCTPJ-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClO2 |
|---|---|
| Molecular weight | 263.51 g/mol |
| IUPAC name | (4-bromo-2,6-dimethylphenyl) carbonochloridate |
| InChIKey | SGLZHKPOXRCTPJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1OC(=O)Cl)C)Br |
Computed by PubChem (NCBI)