Products 203379-83-3
CAS 203379-83-3 appears in our catalog under these names: 2,2’-Dimethyl-[1,1’-biphenyl]-3,3’-diamine, ≥97%, ≥97%, 2,2’-Dimethyl-[1,1’-biphenyl]-3,3’-diamine, ≥97%. Offered by: Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
3-(3-amino-2-methylphenyl)-2-methylaniline (CAS 203379-83-3) is a chemical compound with the molecular formula C14H16N2 and a molecular weight of 212.29 g/mol. IUPAC name: 3-(3-amino-2-methylphenyl)-2-methylaniline. InChIKey: USZDIDKMNBWRLR-UHFFFAOYSA-N.
| Molecular formula | C14H16N2 |
|---|---|
| Molecular weight | 212.29 g/mol |
| IUPAC name | 3-(3-amino-2-methylphenyl)-2-methylaniline |
| InChIKey | USZDIDKMNBWRLR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1N)C2=C(C(=CC=C2)N)C |
Computed by PubChem (NCBI)