CAS 2034157-21-4 is the registry number for 3-(2-Methoxyethyl)-5,7-dimethylbenzo[d]thiazol-2(3H)-imine 4-methylbenzenesulfonate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(2-methoxyethyl)-5,7-dimethyl-1,3-benzothiazol-2-imine;4-methylbenzenesulfonic acid (CAS 2034157-21-4) is a chemical compound with the molecular formula C19H24N2O4S2 and a molecular weight of 408.5 g/mol. IUPAC name: 3-(2-methoxyethyl)-5,7-dimethyl-1,3-benzothiazol-2-imine;4-methylbenzenesulfonic acid. InChIKey: UDHNTPFPVIKBBS-UHFFFAOYSA-N.
| Molecular formula | C19H24N2O4S2 |
|---|---|
| Molecular weight | 408.5 g/mol |
| IUPAC name | 3-(2-methoxyethyl)-5,7-dimethyl-1,3-benzothiazol-2-imine;4-methylbenzenesulfonic acid |
| InChIKey | UDHNTPFPVIKBBS-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.CC1=CC(=C2C(=C1)N(C(=N)S2)CCOC)C |
Computed by PubChem (NCBI)