CAS 5769-35-7 appears in our catalog under these names: 1,4-Ditosyl-1,4-diazepane, 95%, Fasudil Impurity 30, 1,4–Ditosyl–1,4–diazepane, 1,4-Ditosyl-1,4-diazepane 95%, 1,4-Ditosyl-1,4-diazepane, 95%, 95%. Offered by: Combi-blocks, Chemat Brand, GLPBio, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 25g, 10g, 5g, on request, 100mg.
1,4-bis-(4-methylphenyl)sulfonyl-1,4-diazepane (CAS 5769-35-7) is a chemical compound with the molecular formula C19H24N2O4S2 and a molecular weight of 408.5 g/mol. IUPAC name: 1,4-bis-(4-methylphenyl)sulfonyl-1,4-diazepane. InChIKey: ORANQSHSAIBPEC-UHFFFAOYSA-N.
| Molecular formula | C19H24N2O4S2 |
|---|---|
| Molecular weight | 408.5 g/mol |
| IUPAC name | 1,4-bis-(4-methylphenyl)sulfonyl-1,4-diazepane |
| InChIKey | ORANQSHSAIBPEC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CCCN(CC2)S(=O)(=O)C3=CC=C(C=C3)C |
Computed by PubChem (NCBI)