CAS 2034157-13-4 is the registry number for 3-(2-Ethoxyethyl)-6-methylbenzo[d]thiazol-2(3H)-imine 4-methylbenzenesulfonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(2-ethoxyethyl)-6-methyl-1,3-benzothiazol-2-imine;4-methylbenzenesulfonic acid (CAS 2034157-13-4) is a chemical compound with the molecular formula C19H24N2O4S2 and a molecular weight of 408.5 g/mol. IUPAC name: 3-(2-ethoxyethyl)-6-methyl-1,3-benzothiazol-2-imine;4-methylbenzenesulfonic acid. InChIKey: LXYUDGKEFOTBRV-UHFFFAOYSA-N.
| Molecular formula | C19H24N2O4S2 |
|---|---|
| Molecular weight | 408.5 g/mol |
| IUPAC name | 3-(2-ethoxyethyl)-6-methyl-1,3-benzothiazol-2-imine;4-methylbenzenesulfonic acid |
| InChIKey | LXYUDGKEFOTBRV-UHFFFAOYSA-N |
| SMILES | CCOCCN1C2=C(C=C(C=C2)C)SC1=N.CC1=CC=C(C=C1)S(=O)(=O)O |
Computed by PubChem (NCBI)