CAS 203450-08-2 appears in our catalog under these names: 2–(4–Fluorophenyl)–4,6–diphenyl–1,3,5–triazine, 2-(4-Fluorophenyl)-4,6-diphenyl-1,3,5-triazine, 97%, 2-(4-Fluorophenyl)-4,6-diphenyl-1,3,5-triazine, >98.0%(GC), 2-(4-Fluorophenyl)-4,6-diphenyl-1,3,5-triazine, 97%, 97%. Offered by: GLPBio, Fluorochem, Ambeed, TCI, Chemat. Available pack sizes: 1g, 25g, 5g, 10g, 250mg, 200mg.
2-(4-fluorophenyl)-4,6-diphenyl-1,3,5-triazine (CAS 203450-08-2) is a chemical compound with the molecular formula C21H14FN3 and a molecular weight of 327.4 g/mol. IUPAC name: 2-(4-fluorophenyl)-4,6-diphenyl-1,3,5-triazine. InChIKey: DEFTZOFCLNDIMR-UHFFFAOYSA-N.
| Molecular formula | C21H14FN3 |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | 2-(4-fluorophenyl)-4,6-diphenyl-1,3,5-triazine |
| InChIKey | DEFTZOFCLNDIMR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NC(=N2)C3=CC=C(C=C3)F)C4=CC=CC=C4 |
Computed by PubChem (NCBI)