CAS 209901-86-0 appears in our catalog under these names: 4'-(4-Fluorophenyl)-2,2':6',2''-terpyridine, 98%, 4'-(4-Fluorophenyl)-2,2':6',2''-terpyridine, 98%, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
4-(4-fluorophenyl)-2,6-dipyridin-2-ylpyridine (CAS 209901-86-0) is a chemical compound with the molecular formula C21H14FN3 and a molecular weight of 327.4 g/mol. IUPAC name: 4-(4-fluorophenyl)-2,6-dipyridin-2-ylpyridine. InChIKey: MYQQZCVIAQFISL-UHFFFAOYSA-N.
| Molecular formula | C21H14FN3 |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | 4-(4-fluorophenyl)-2,6-dipyridin-2-ylpyridine |
| InChIKey | MYQQZCVIAQFISL-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC(=CC(=N2)C3=CC=CC=N3)C4=CC=C(C=C4)F |
Computed by PubChem (NCBI)