CAS 203508-62-7 is the registry number for 1–((3S)–6–methyl–7–oxabicyclo(4,1,0)heptan–3–yl)ethanone. Offered by: GLPBio. Available pack sizes: 1g.
1-[(3S)-6-methyl-7-oxabicyclo[4.1.0]heptan-3-yl]ethanone (CAS 203508-62-7) is a chemical compound with the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. IUPAC name: 1-[(3S)-6-methyl-7-oxabicyclo[4.1.0]heptan-3-yl]ethanone. InChIKey: VPQYGKRHSKLXJB-UEJVZZJDSA-N.
| Molecular formula | C9H14O2 |
|---|---|
| Molecular weight | 154.21 g/mol |
| IUPAC name | 1-[(3S)-6-methyl-7-oxabicyclo[4.1.0]heptan-3-yl]ethanone |
| InChIKey | VPQYGKRHSKLXJB-UEJVZZJDSA-N |
| SMILES | CC(=O)[C@H]1CCC2(C(C1)O2)C |
Computed by PubChem (NCBI)