Products 2036323-75-6
CAS 2036323-75-6 is the registry number for H-L-Phe(3-MeTz)-OH*TFA. Offered by: Iris Biotech. Available pack sizes: 25mg, 100mg.
(2S)-2-amino-3-[3-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl]propanoic acid (CAS 2036323-75-6) is a chemical compound with the molecular formula C12H13N5O2 and a molecular weight of 259.26 g/mol. IUPAC name: (2S)-2-amino-3-[3-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl]propanoic acid. InChIKey: BNHSSOURIMSVHQ-JTQLQIEISA-N.
| Molecular formula | C12H13N5O2 |
|---|---|
| Molecular weight | 259.26 g/mol |
| IUPAC name | (2S)-2-amino-3-[3-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl]propanoic acid |
| InChIKey | BNHSSOURIMSVHQ-JTQLQIEISA-N |
| SMILES | CC1=NN=C(N=N1)C2=CC=CC(=C2)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)