CAS 71552-34-6 is the registry number for 6-Ethyl-5-(4-nitrophenyl)-2,4-pyrimidinediamine, >95% (HPLC). Offered by: TRC. Available pack sizes: 2,5g, 250mg.
6-ethyl-5-(4-nitrophenyl)pyrimidine-2,4-diamine (CAS 71552-34-6) is a chemical compound with the molecular formula C12H13N5O2 and a molecular weight of 259.26 g/mol. IUPAC name: 6-ethyl-5-(4-nitrophenyl)pyrimidine-2,4-diamine. InChIKey: MABNISKVRMEKMS-UHFFFAOYSA-N.
| Molecular formula | C12H13N5O2 |
|---|---|
| Molecular weight | 259.26 g/mol |
| IUPAC name | 6-ethyl-5-(4-nitrophenyl)pyrimidine-2,4-diamine |
| InChIKey | MABNISKVRMEKMS-UHFFFAOYSA-N |
| SMILES | CCC1=C(C(=NC(=N1)N)N)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)