CAS 436088-53-8 is the registry number for 1H-imidazole-4,5-dicarboxylicacid4-[(4-amino-phenyl)-amide]5-methylamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-N-(4-aminophenyl)-5-N-methyl-1H-imidazole-4,5-dicarboxamide (CAS 436088-53-8) is a chemical compound with the molecular formula C12H13N5O2 and a molecular weight of 259.26 g/mol. IUPAC name: 4-N-(4-aminophenyl)-5-N-methyl-1H-imidazole-4,5-dicarboxamide. InChIKey: CNIFNMYBLJUKQF-UHFFFAOYSA-N.
| Molecular formula | C12H13N5O2 |
|---|---|
| Molecular weight | 259.26 g/mol |
| IUPAC name | 4-N-(4-aminophenyl)-5-N-methyl-1H-imidazole-4,5-dicarboxamide |
| InChIKey | CNIFNMYBLJUKQF-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=C(N=CN1)C(=O)NC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)