Products 203633-18-5
CAS 203633-18-5 appears in our catalog under these names: n-Tridecyl-d27 Alcohol, 98 atom % D, min 98% Chemical Purity, 1-Tridecanol-d27, 98.7%. Offered by: CDN, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 100 mg, 10 mg, 25 mg, 50 mg, 5 mg.
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-heptacosadeuteriotridecan-1-ol (CAS 203633-18-5) is a chemical compound with the molecular formula C13H28O and a molecular weight of 227.53 g/mol. IUPAC name: 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-heptacosadeuteriotridecan-1-ol. InChIKey: XFRVVPUIAFSTFO-RZVOLPTOSA-N.
| Molecular formula | C13H28O |
|---|---|
| Molecular weight | 227.53 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-heptacosadeuteriotridecan-1-ol |
| InChIKey | XFRVVPUIAFSTFO-RZVOLPTOSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])O |
Computed by PubChem (NCBI)
Synonyms:
n-Tridecyl Alcohol-d27