CAS 41902-42-5 appears in our catalog under these names: 3-(Tert-butyl)-2,2,4,4-tetramethylpentan-3-ol 98%, Tri-tert-butylmethanol, 98%, 98%, 3-(Tert-butyl)-2,2,4,4-tetramethylpentan-3-ol, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
3-tert-butyl-2,2,4,4-tetramethylpentan-3-ol (CAS 41902-42-5) is a chemical compound with the molecular formula C13H28O and a molecular weight of 200.36 g/mol. IUPAC name: 3-tert-butyl-2,2,4,4-tetramethylpentan-3-ol. InChIKey: LIUBOLYWYDGCSJ-UHFFFAOYSA-N.
| Molecular formula | C13H28O |
|---|---|
| Molecular weight | 200.36 g/mol |
| IUPAC name | 3-tert-butyl-2,2,4,4-tetramethylpentan-3-ol |
| InChIKey | LIUBOLYWYDGCSJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(C(C)(C)C)(C(C)(C)C)O |
Computed by PubChem (NCBI)