Products 203784-57-0
CAS 203784-57-0 appears in our catalog under these names: 2-Aminopyridine-d6, 2-Aminopyridine-d6, 98 atom % D, min 98% Chemical Purity. Offered by: TRC, CDN. Available pack sizes: 2mg, 4mg, 0,5g, 0,25g.
N,N,3,4,5,6-hexadeuteriopyridin-2-amine (CAS 203784-57-0) is a chemical compound with the molecular formula C5H6N2 and a molecular weight of 100.15 g/mol. IUPAC name: N,N,3,4,5,6-hexadeuteriopyridin-2-amine. InChIKey: ICSNLGPSRYBMBD-UDDMDDBKSA-N.
| Molecular formula | C5H6N2 |
|---|---|
| Molecular weight | 100.15 g/mol |
| IUPAC name | N,N,3,4,5,6-hexadeuteriopyridin-2-amine |
| InChIKey | ICSNLGPSRYBMBD-UDDMDDBKSA-N |
| SMILES | [2H]C1=C(C(=NC(=C1[2H])N([2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)