CAS 87802-54-8 appears in our catalog under these names: 2-Pyridinamine-d4, >95% (HPLC), 2–(2H4)Pyridinamine. Offered by: TRC, GLPBio. Available pack sizes: 10mg, 25mg, 50mg, 20mg.
3,4,5,6-tetradeuteriopyridin-2-amine (CAS 87802-54-8) is a chemical compound with the molecular formula C5H6N2 and a molecular weight of 98.14 g/mol. IUPAC name: 3,4,5,6-tetradeuteriopyridin-2-amine. InChIKey: ICSNLGPSRYBMBD-RHQRLBAQSA-N.
| Molecular formula | C5H6N2 |
|---|---|
| Molecular weight | 98.14 g/mol |
| IUPAC name | 3,4,5,6-tetradeuteriopyridin-2-amine |
| InChIKey | ICSNLGPSRYBMBD-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=NC(=C1[2H])N)[2H])[2H] |
Computed by PubChem (NCBI)