Products 203784-63-8
CAS 203784-63-8 appears in our catalog under these names: DL-Valine-d8, 98 atom % D, min 98% Chemical Purity, DL–Valine–d8, DL-VALINE-2,3,4,4,4,5,5,5-D8, 98 ATOM %&, DL-Valine-d8, 99.96%. Offered by: CDN, GLPBio, Sigma-Aldrich, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 100mg, 10mg, 5mg, 50mg, 1G, 10 mg.
2-amino-2,3,4,4,4-pentadeuterio-3-(trideuteriomethyl)butanoic acid (CAS 203784-63-8) is a chemical compound with the molecular formula C5H11NO2 and a molecular weight of 125.20 g/mol. IUPAC name: 2-amino-2,3,4,4,4-pentadeuterio-3-(trideuteriomethyl)butanoic acid. InChIKey: KZSNJWFQEVHDMF-PIODKIDGSA-N.
| Molecular formula | C5H11NO2 |
|---|---|
| Molecular weight | 125.20 g/mol |
| IUPAC name | 2-amino-2,3,4,4,4-pentadeuterio-3-(trideuteriomethyl)butanoic acid |
| InChIKey | KZSNJWFQEVHDMF-PIODKIDGSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])C([2H])(C(=O)O)N |
Computed by PubChem (NCBI)