Products 83181-79-7
CAS 83181-79-7 appears in our catalog under these names: DL-Valine-2,3-d2, 98 atom % D, min 98% Chemical Purity, DL-Valine-d2. Offered by: CDN, MedChemExpress. Available pack sizes: 0,05g, 0,01g, 5 mg, 10 mg, 1 mg.
2-amino-2,3-dideuterio-3-methylbutanoic acid (CAS 83181-79-7) is a chemical compound with the molecular formula C5H11NO2 and a molecular weight of 119.16 g/mol. IUPAC name: 2-amino-2,3-dideuterio-3-methylbutanoic acid. InChIKey: KZSNJWFQEVHDMF-NMQOAUCRSA-N.
| Molecular formula | C5H11NO2 |
|---|---|
| Molecular weight | 119.16 g/mol |
| IUPAC name | 2-amino-2,3-dideuterio-3-methylbutanoic acid |
| InChIKey | KZSNJWFQEVHDMF-NMQOAUCRSA-N |
| SMILES | [2H]C(C)(C)C([2H])(C(=O)O)N |
Computed by PubChem (NCBI)