CAS 20379-60-6 is the registry number for a-D-Glucopyranosyl azide. Offered by: Biosynth. Available pack sizes: 5g.
(2S,3R,4S,5S,6R)-2-azido-6-(hydroxymethyl)oxane-3,4,5-triol (CAS 20379-60-6) is a chemical compound with the molecular formula C6H11N3O5 and a molecular weight of 205.17 g/mol. IUPAC name: (2S,3R,4S,5S,6R)-2-azido-6-(hydroxymethyl)oxane-3,4,5-triol. InChIKey: KSRDTSABQYNYMP-DVKNGEFBSA-N.
| Molecular formula | C6H11N3O5 |
|---|---|
| Molecular weight | 205.17 g/mol |
| IUPAC name | (2S,3R,4S,5S,6R)-2-azido-6-(hydroxymethyl)oxane-3,4,5-triol |
| InChIKey | KSRDTSABQYNYMP-DVKNGEFBSA-N |
| SMILES | C([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)N=[N+]=[N-])O)O)O)O |
Computed by PubChem (NCBI)