CAS 20380-56-7 appears in our catalog under these names: Ethyl (1RS,2RS)-2-(Dimethylamino)-1-phenylcyclohex-3-enecarboxylate (cis-Tilidine), cis-Tilidine (Ethyl (1RS,2RS)-2-(Dimethyl-amino)-1-phenylcyclohex-3-enecarboxylate). Offered by: Mikromol, LoGiCal. Available pack sizes: 100mg, 10mg.
Ethyl (1S,2S)-2-(dimethylamino)-1-phenylcyclohex-3-ene-1-carboxylate (CAS 20380-56-7) is a chemical compound with the molecular formula C17H23NO2 and a molecular weight of 273.37 g/mol. IUPAC name: ethyl (1S,2S)-2-(dimethylamino)-1-phenylcyclohex-3-ene-1-carboxylate. InChIKey: WDEFBBTXULIOBB-RDJZCZTQSA-N.
| Molecular formula | C17H23NO2 |
|---|---|
| Molecular weight | 273.37 g/mol |
| IUPAC name | ethyl (1S,2S)-2-(dimethylamino)-1-phenylcyclohex-3-ene-1-carboxylate |
| InChIKey | WDEFBBTXULIOBB-RDJZCZTQSA-N |
| SMILES | CCOC(=O)[C@@]1(CCC=C[C@@H]1N(C)C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)