CAS 2039-68-1 is the registry number for 4,4'-Diphenylstilbene. Offered by: Biosynth. Available pack sizes: 1kg.
1-phenyl-4-[(E)-2-(4-phenylphenyl)ethenyl]benzene (CAS 2039-68-1) is a chemical compound with the molecular formula C26H20 and a molecular weight of 332.4 g/mol. IUPAC name: 1-phenyl-4-[(E)-2-(4-phenylphenyl)ethenyl]benzene. InChIKey: HXWQJYVUJPBQEW-VAWYXSNFSA-N.
| Molecular formula | C26H20 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | 1-phenyl-4-[(E)-2-(4-phenylphenyl)ethenyl]benzene |
| InChIKey | HXWQJYVUJPBQEW-VAWYXSNFSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)/C=C/C3=CC=C(C=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)