CAS 32057-88-8 appears in our catalog under these names: 2,7-Distyrylnaphthalene, 95%, 2,7–Di((E)–styryl)naphthalene. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g.
2,7-bis[(E)-2-phenylethenyl]naphthalene (CAS 32057-88-8) is a chemical compound with the molecular formula C26H20 and a molecular weight of 332.4 g/mol. IUPAC name: 2,7-bis[(E)-2-phenylethenyl]naphthalene. InChIKey: BAXGJINOQBOMFG-PHEQNACWSA-N.
| Molecular formula | C26H20 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | 2,7-bis[(E)-2-phenylethenyl]naphthalene |
| InChIKey | BAXGJINOQBOMFG-PHEQNACWSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C2=CC3=C(C=C2)C=CC(=C3)/C=C/C4=CC=CC=C4 |
Computed by PubChem (NCBI)