Products 204-03-5
CAS 204-03-5 appears in our catalog under these names: 1H-Naphtho[1,8-de]-1,2,3-triazine, 98%, 98%, 1H-naphtho[1,8-de][1,2,3]triazine, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 10mg, 50mg, 100mg, 250mg, 1g, 5g.
2,3,4-triazatricyclo[7.3.1.05,13]trideca-1(12),2,5,7,9(13),10-hexaene (CAS 204-03-5) is a chemical compound with the molecular formula C10H7N3 and a molecular weight of 169.18 g/mol. IUPAC name: 2,3,4-triazatricyclo[7.3.1.05,13]trideca-1(12),2,5,7,9(13),10-hexaene. InChIKey: JTCCAXGPZWYNEQ-UHFFFAOYSA-N.
| Molecular formula | C10H7N3 |
|---|---|
| Molecular weight | 169.18 g/mol |
| IUPAC name | 2,3,4-triazatricyclo[7.3.1.05,13]trideca-1(12),2,5,7,9(13),10-hexaene |
| InChIKey | JTCCAXGPZWYNEQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)NN=NC3=CC=C2 |
Computed by PubChem (NCBI)