CAS 2040-01-9 appears in our catalog under these names: 2',3',4',5',6'–PentaMethylacetophenone, 2,3,4,5,6-Pentamethylacetophenone, 97%, 97%. Offered by: GLPBio, Chemat. Available pack sizes: 25g, 100mg, 250mg, 1g.
1-(2,3,4,5,6-pentamethylphenyl)ethanone (CAS 2040-01-9) is a chemical compound with the molecular formula C13H18O and a molecular weight of 190.28 g/mol. IUPAC name: 1-(2,3,4,5,6-pentamethylphenyl)ethanone. InChIKey: CTTYWXDVWGKHKJ-UHFFFAOYSA-N.
| Molecular formula | C13H18O |
|---|---|
| Molecular weight | 190.28 g/mol |
| IUPAC name | 1-(2,3,4,5,6-pentamethylphenyl)ethanone |
| InChIKey | CTTYWXDVWGKHKJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1C)C)C(=O)C)C)C |
Computed by PubChem (NCBI)