CAS 2041-19-2 appears in our catalog under these names: 3–Bromo–9H–fluoren–9–one, 3-Bromo-9H-fluoren-9-one, >98.0%(GC), 3-Bromo-9H-fluoren-9-one 97%, 3-Bromo-9H-fluoren-9-one, 98%, 98%, 3-Bromo-9H-fluoren-9-one, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 100g.
3-bromofluoren-9-one (CAS 2041-19-2) is a chemical compound with the molecular formula C13H7BrO and a molecular weight of 259.10 g/mol. IUPAC name: 3-bromofluoren-9-one. InChIKey: XWRAQISPRVFAQK-UHFFFAOYSA-N.
| Molecular formula | C13H7BrO |
|---|---|
| Molecular weight | 259.10 g/mol |
| IUPAC name | 3-bromofluoren-9-one |
| InChIKey | XWRAQISPRVFAQK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C2=O)C=CC(=C3)Br |
Computed by PubChem (NCBI)