CAS 3096-56-8 appears in our catalog under these names: 2–Bromo–9–fluorenone, 2-Bromo-9-fluorenone, >98.0%(GC), 2-Bromo-9H-fluoren-9-one 97%, 2-Bromo-9H-fluoren-9-one, 98%, 98%, 2-Bromofluoren-9-one, 95%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 500g, 5g, 25g, 1g, 1000g, 10g, 1kg.
2-bromofluoren-9-one (CAS 3096-56-8) is a chemical compound with the molecular formula C13H7BrO and a molecular weight of 259.10 g/mol. IUPAC name: 2-bromofluoren-9-one. InChIKey: MTCARZDHUIEYMB-UHFFFAOYSA-N.
| Molecular formula | C13H7BrO |
|---|---|
| Molecular weight | 259.10 g/mol |
| IUPAC name | 2-bromofluoren-9-one |
| InChIKey | MTCARZDHUIEYMB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C2=O)C=C(C=C3)Br |
Computed by PubChem (NCBI)