CAS 2041076-41-7 is the registry number for 3-Amino-6,7-dihydropyrazolo[1,5-a]pyrazin-4(5H)-one hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-amino-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one;hydrochloride (CAS 2041076-41-7) is a chemical compound with the molecular formula C6H9ClN4O and a molecular weight of 188.61 g/mol. IUPAC name: 3-amino-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one;hydrochloride. InChIKey: BIOVHJRYHRDQRM-UHFFFAOYSA-N.
| Molecular formula | C6H9ClN4O |
|---|---|
| Molecular weight | 188.61 g/mol |
| IUPAC name | 3-amino-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one;hydrochloride |
| InChIKey | BIOVHJRYHRDQRM-UHFFFAOYSA-N |
| SMILES | C1CN2C(=C(C=N2)N)C(=O)N1.Cl |
Computed by PubChem (NCBI)