CAS 96017-23-1 is the registry number for 4-Chloro-2-methyl-5-(1-methylhydrazin-1-yl)-2,3-dihydropyridazin-3-one, 98%. Offered by: Fluorochem. Available pack sizes: 250mg, 1g.
5-[amino(methyl)amino]-4-chloro-2-methylpyridazin-3-one (CAS 96017-23-1) is a chemical compound with the molecular formula C6H9ClN4O and a molecular weight of 188.61 g/mol. IUPAC name: 5-[amino(methyl)amino]-4-chloro-2-methylpyridazin-3-one. InChIKey: UKPMAZBURJFXCB-UHFFFAOYSA-N.
| Molecular formula | C6H9ClN4O |
|---|---|
| Molecular weight | 188.61 g/mol |
| IUPAC name | 5-[amino(methyl)amino]-4-chloro-2-methylpyridazin-3-one |
| InChIKey | UKPMAZBURJFXCB-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C(=C(C=N1)N(C)N)Cl |
Computed by PubChem (NCBI)