CAS 2041786-47-2 is the registry number for tert-Butyl (3S)-3-(aminomethyl)-4,4-difluoropiperidine-1-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl (3S)-3-(aminomethyl)-4,4-difluoropiperidine-1-carboxylate (CAS 2041786-47-2) is a chemical compound with the molecular formula C11H20F2N2O2 and a molecular weight of 250.29 g/mol. IUPAC name: tert-butyl (3S)-3-(aminomethyl)-4,4-difluoropiperidine-1-carboxylate. InChIKey: BGZSTQMQTTUBPO-QMMMGPOBSA-N.
| Molecular formula | C11H20F2N2O2 |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | tert-butyl (3S)-3-(aminomethyl)-4,4-difluoropiperidine-1-carboxylate |
| InChIKey | BGZSTQMQTTUBPO-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC([C@H](C1)CN)(F)F |
Computed by PubChem (NCBI)