CAS 2041844-34-0 is the registry number for Rel-(2R,4R)-4-(hydroxymethyl)-2-methyltetrahydro-2H-thiopyran 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,4R)-2-methyl-1,1-dioxothian-4-yl]methanol (CAS 2041844-34-0) is a chemical compound with the molecular formula C7H14O3S and a molecular weight of 178.25 g/mol. IUPAC name: [(2R,4R)-2-methyl-1,1-dioxothian-4-yl]methanol. InChIKey: PQPJWAVJLURCTR-RNFRBKRXSA-N.
| Molecular formula | C7H14O3S |
|---|---|
| Molecular weight | 178.25 g/mol |
| IUPAC name | [(2R,4R)-2-methyl-1,1-dioxothian-4-yl]methanol |
| InChIKey | PQPJWAVJLURCTR-RNFRBKRXSA-N |
| SMILES | C[C@@H]1C[C@@H](CCS1(=O)=O)CO |
Computed by PubChem (NCBI)