Products 70074-03-2

CAS 70074-03-2 is the registry number for 2,2-Dimethylbut-3-en-1-yl methanesulfonate, 95% +(stabilized with TBC). Offered by: AmBeed. Available pack sizes: 1g.

2,2-dimethylbut-3-enyl methanesulfonate (CAS 70074-03-2) is a chemical compound with the molecular formula C7H14O3S and a molecular weight of 178.25 g/mol. IUPAC name: 2,2-dimethylbut-3-enyl methanesulfonate. InChIKey: SPSPGOSYWMPBHF-UHFFFAOYSA-N.

Identity
Molecular formulaC7H14O3S
Molecular weight178.25 g/mol
IUPAC name2,2-dimethylbut-3-enyl methanesulfonate
InChIKeySPSPGOSYWMPBHF-UHFFFAOYSA-N
SMILESCC(C)(COS(=O)(=O)C)C=C

Computed by PubChem (NCBI)