Products 2042196-71-2
CAS 2042196-71-2 is the registry number for N-[4-(Hydroxymethyl)-2-isopropylphenyl]acetamide, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
N-[4-(hydroxymethyl)-2-propan-2-ylphenyl]acetamide (CAS 2042196-71-2) is a chemical compound with the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. IUPAC name: N-[4-(hydroxymethyl)-2-propan-2-ylphenyl]acetamide. InChIKey: JOJMDJVTICLRIQ-UHFFFAOYSA-N.
| Molecular formula | C12H17NO2 |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | N-[4-(hydroxymethyl)-2-propan-2-ylphenyl]acetamide |
| InChIKey | JOJMDJVTICLRIQ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C=CC(=C1)CO)NC(=O)C |
Computed by PubChem (NCBI)