CAS 204316-36-9 appears in our catalog under these names: (S)–2–((((9H–Fluoren–9–yl)methoxy)carbonyl)amino)–3–(((benzyloxy)carbonyl)amino)propanoic acid, Fmoc-L-Dap(Z)-OH, Fmoc-Dap(Z)-OH, Fmoc-Dap(Z)-OH 98%, Fmoc-Dap(Z)-OH, 98%, 98%. Offered by: GLPBio, Iris Biotech, Biosynth, Ambeed, Chemat. Available pack sizes: 10g, 5g, 25g, 250mg, 1g, 50g, 100g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(phenylmethoxycarbonylamino)propanoic acid (CAS 204316-36-9) is a chemical compound with the molecular formula C26H24N2O6 and a molecular weight of 460.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(phenylmethoxycarbonylamino)propanoic acid. InChIKey: CDAHZCMBWKGJEC-QHCPKHFHSA-N.
| Molecular formula | C26H24N2O6 |
|---|---|
| Molecular weight | 460.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(phenylmethoxycarbonylamino)propanoic acid |
| InChIKey | CDAHZCMBWKGJEC-QHCPKHFHSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NC[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)