CAS 327981-01-1 appears in our catalog under these names: Z-Gln(xan)-oh, 98%, (S)-5-((9H-Xanthen-9-yl)amino)-2-(((benzyloxy)carbonyl)amino)-5-oxopentanoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 25g, 5g.
(2S)-5-oxo-2-(phenylmethoxycarbonylamino)-5-(9H-xanthen-9-ylamino)pentanoic acid (CAS 327981-01-1) is a chemical compound with the molecular formula C26H24N2O6 and a molecular weight of 460.5 g/mol. IUPAC name: (2S)-5-oxo-2-(phenylmethoxycarbonylamino)-5-(9H-xanthen-9-ylamino)pentanoic acid. InChIKey: LHCASNYXSAWPNX-FQEVSTJZSA-N.
| Molecular formula | C26H24N2O6 |
|---|---|
| Molecular weight | 460.5 g/mol |
| IUPAC name | (2S)-5-oxo-2-(phenylmethoxycarbonylamino)-5-(9H-xanthen-9-ylamino)pentanoic acid |
| InChIKey | LHCASNYXSAWPNX-FQEVSTJZSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@@H](CCC(=O)NC2C3=CC=CC=C3OC4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)